CAS 1255147-47-7
:Methyl 7-fluoro-3-methyl-1H-indole-2-carboxylate
Description:
Methyl 7-fluoro-3-methyl-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methyl group and a fluoro substituent at specific positions on the indole ring contributes to its unique chemical properties and potential biological activity. The carboxylate functional group indicates that it is an ester, which can influence its solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, and the presence of the fluorine atom may enhance its metabolic stability or lipophilicity. As with many indole derivatives, it may also be involved in various synthetic pathways, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H10FNO2
InChI:InChI=1S/C11H10FNO2/c1-6-7-4-3-5-8(12)10(7)13-9(6)11(14)15-2/h3-5,13H,1-2H3
InChI key:InChIKey=MUHXAYGORUNHSG-UHFFFAOYSA-N
SMILES:FC1=C2C(C(C)=C(C(OC)=O)N2)=CC=C1
Synonyms:- 1H-Indole-2-carboxylic acid, 7-fluoro-3-methyl-, methyl ester
- Methyl 7-fluoro-3-methyl-1H-indole-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.