CAS 1255147-49-9
:α-Ethyl-4-methyl-1H-pyrazole-1-acetic acid hydrazide
Description:
α-Ethyl-4-methyl-1H-pyrazole-1-acetic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity and reactivity due to the presence of the hydrazide moiety. It may be soluble in polar solvents, reflecting the hydrophilic nature of the hydrazide group, while the pyrazole ring can contribute to its stability and potential interactions with biological targets. The compound's structure suggests it may participate in various chemical reactions, including acylation and condensation, making it of interest in medicinal chemistry and drug development. Additionally, its specific interactions and applications would depend on the functional groups present and the overall molecular conformation. As with many pyrazole derivatives, it may also exhibit pharmacological properties, warranting further investigation into its potential therapeutic uses.
Formula:C8H14N4O
InChI:InChI=1S/C8H14N4O/c1-3-7(8(13)11-9)12-5-6(2)4-10-12/h4-5,7H,3,9H2,1-2H3,(H,11,13)
InChI key:InChIKey=KCPIQZGFVRVTIN-UHFFFAOYSA-N
SMILES:C(C(NN)=O)(CC)N1C=C(C)C=N1
Synonyms:- 1H-Pyrazole-1-acetic acid, α-ethyl-4-methyl-, hydrazide
- α-Ethyl-4-methyl-1H-pyrazole-1-acetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.