CAS 1255147-56-8
:4-Chloro-1-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole
Description:
4-Chloro-1-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and two ethoxy groups at the 1-position contributes to its unique chemical properties. The compound features a branched alkyl chain, specifically a 2,2-diethoxyethyl group, which enhances its solubility in organic solvents. The dimethyl groups at the 3 and 5 positions of the pyrazole ring provide additional steric hindrance and influence its reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. The presence of chlorine may also impart specific reactivity patterns, such as nucleophilic substitution. Overall, the combination of functional groups and structural features makes this compound a subject of interest in various chemical research fields.
Formula:C11H19ClN2O2
InChI:InChI=1S/C11H19ClN2O2/c1-5-15-10(16-6-2)7-14-9(4)11(12)8(3)13-14/h10H,5-7H2,1-4H3
InChI key:InChIKey=JFUPTSPWUBPIBH-UHFFFAOYSA-N
SMILES:C(C(OCC)OCC)N1C(C)=C(Cl)C(C)=N1
Synonyms:- 1H-Pyrazole, 4-chloro-1-(2,2-diethoxyethyl)-3,5-dimethyl-
- 4-Chloro-1-(2,2-diethoxyethyl)-3,5-dimethyl-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.