CAS 1255147-58-0

5-[3-Methoxy-4-(1-methylethoxy)phenyl]-1,3-cyclohexanedione

Description:

5-[3-Methoxy-4-(1-methylethoxy)phenyl]-1,3-cyclohexanedione, identified by its CAS number 1255147-58-0, is an organic compound characterized by its complex molecular structure, which includes a cyclohexanedione core and a substituted phenyl group. The presence of methoxy and 1-methylethoxy groups contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and interaction with biological systems. This compound may exhibit specific functional properties such as antioxidant activity or potential applications in pharmaceuticals or agrochemicals, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or condensation reactions, depending on the conditions. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Further research would be essential to fully understand its characteristics and applications in various fields.

Formula: C₁₆H₂₀O₄

InChI: InChI=1S/C16H20O4/c1-10(2)20-15-5-4-11(8-16(15)19-3)12-6-13(17)9-14(18)7-12/h4-5,8,10,12H,6-7,9H2,1-3H3

InChI key: InChIKey=ZIEUSLXWERFDGM-UHFFFAOYSA-N

SMILES: O=C1CC(CC(=O)C1)C2=CC(OC)=C(OC(C)C)C=C2

Synonyms:

• 5-[3-Methoxy-4-(1-methylethoxy)phenyl]-1,3-cyclohexanedione
• 1,3-Cyclohexanedione, 5-[3-methoxy-4-(1-methylethoxy)phenyl]-
• 5-(4-Isopropoxy-3-methoxyphenyl)cyclohexane-1,3-dione