
CAS 1255147-59-1
:5-Hydroxy-1-[2-(1-methylethyl)phenyl]-3-pyrrolidinecarboxylic acid
Description:
5-Hydroxy-1-[2-(1-methylethyl)phenyl]-3-pyrrolidinecarboxylic acid, with the CAS number 1255147-59-1, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a hydroxyl group and a phenyl group that has an isopropyl substituent. The presence of the hydroxyl group suggests that it may exhibit properties typical of alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The isopropyl group contributes to the compound's hydrophobic characteristics, influencing its overall solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for biological activity or pharmacological properties. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c1-9(2)11-5-3-4-6-12(11)15-8-10(14(17)18)7-13(15)16/h3-6,9-10,13,16H,7-8H2,1-2H3,(H,17,18)
InChI key:InChIKey=WUHLHTXBWLRYKD-UHFFFAOYSA-N
SMILES:OC1N(CC(C(O)=O)C1)C2=C(C(C)C)C=CC=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 5-hydroxy-1-[2-(1-methylethyl)phenyl]-
- 5-Hydroxy-1-[2-(1-methylethyl)phenyl]-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.