CymitQuimica logo

CAS 1255147-61-5

:

10-Fluoro-2-methylpyrimido[1,2-b]indazol-4-ol

Description:
10-Fluoro-2-methylpyrimido[1,2-b]indazol-4-ol is a chemical compound characterized by its unique structural features, which include a fluorine atom and a pyrimidine-indazole framework. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The hydroxyl group at the 4-position may contribute to hydrogen bonding capabilities, affecting its reactivity and stability. Additionally, the methyl group at the 2-position can impact the steric and electronic properties of the molecule. Overall, this compound's specific characteristics, including its molecular weight, melting point, and spectral properties, would be essential for understanding its behavior in various chemical environments and potential applications in drug development or other fields of research. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C11H8FN3O
InChI:InChI=1S/C11H8FN3O/c1-6-5-9(16)15-11(13-6)10-7(12)3-2-4-8(10)14-15/h2-5,16H,1H3
InChI key:InChIKey=ZYUYSIOLJFXPAO-UHFFFAOYSA-N
SMILES:FC=1C2=C3N(N=C2C=CC1)C(O)=CC(C)=N3
Synonyms:
  • 10-Fluoro-2-methylpyrimido[1,2-b]indazol-4-ol
  • Pyrimido[1,2-b]indazol-4-ol, 10-fluoro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.