CymitQuimica logo

CAS 1255147-62-6

:

Cyanamide, N-[(4-fluorophenyl)methyl]-

Description:
Cyanamide, N-[(4-fluorophenyl)methyl]- is a chemical compound characterized by its unique structure, which includes a cyanamide functional group and a 4-fluorobenzyl moiety. This compound typically appears as a solid and is soluble in polar solvents. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various organic compounds. The presence of the fluorine atom in the aromatic ring can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry. Additionally, cyanamides are generally recognized for their ability to act as nitrogen sources in various chemical reactions. Safety data indicates that, like many cyanamide derivatives, it may pose health risks if not handled properly, necessitating appropriate safety measures during use. Overall, N-[(4-fluorophenyl)methyl]-cyanamide represents a versatile compound with significant implications in chemical synthesis and research.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c9-8-3-1-7(2-4-8)5-11-6-10/h1-4,11H,5H2
InChI key:InChIKey=RURIUFPRSUBTIL-UHFFFAOYSA-N
SMILES:C(NC#N)C1=CC=C(F)C=C1
Synonyms:
  • Cyanamide N-[(4-fluorophenyl)methyl]-
  • N-(4-Fluorobenzyl)cyanamide
  • Cyanamide, N-[(4-fluorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.