CAS 1255147-63-7
:5-(1-Propoxyethyl)-1,3,4-thiadiazol-2-amine
Description:
5-(1-Propoxyethyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an amine functional group. The presence of the propoxyethyl substituent contributes to its solubility and potential reactivity. Thiadiazoles are known for their diverse biological activities, including antimicrobial and antifungal properties, making this compound of interest in pharmaceutical research. The amine group can participate in hydrogen bonding, influencing the compound's interactions with biological targets. Additionally, the molecular structure suggests potential for various synthetic modifications, which could enhance its efficacy or alter its pharmacokinetic properties. The compound's CAS number, 1255147-63-7, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound position it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C7H13N3OS
InChI:InChI=1S/C7H13N3OS/c1-3-4-11-5(2)6-9-10-7(8)12-6/h5H,3-4H2,1-2H3,(H2,8,10)
InChI key:InChIKey=MTAVIBBZGKMHLR-UHFFFAOYSA-N
SMILES:C(OCCC)(C)C=1SC(N)=NN1
Synonyms:- 5-(1-Propoxyethyl)-1,3,4-thiadiazol-2-amine
- 1,3,4-Thiadiazol-2-amine, 5-(1-propoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.