CAS 1255147-64-8

α,4-Dimethyl-1H-pyrazole-1-acetamide

Description:

α,4-Dimethyl-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 4-position and an acetamide functional group at the 1-position of the pyrazole ring. Its molecular structure contributes to its potential biological activity, making it of interest in various fields, including medicinal chemistry. The presence of the acetamide group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. Additionally, the dimethyl substitution can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are often evaluated for their pharmacological potential, including anti-inflammatory or antimicrobial activities. Overall, α,4-Dimethyl-1H-pyrazole-1-acetamide represents a class of compounds that may have significant applications in drug development and chemical research.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-5-3-9-10(4-5)6(2)7(8)11/h3-4,6H,1-2H3,(H2,8,11)

InChI key: InChIKey=OBQVWMOUOSWTDN-UHFFFAOYSA-N

SMILES: C(C(N)=O)(C)N1N=CC(C)=C1

Synonyms:

• 1H-Pyrazole-1-acetamide, α,4-dimethyl-
• α,4-Dimethyl-1H-pyrazole-1-acetamide