CAS 1255147-66-0

[Imino[4-(4-morpholinylmethyl)phenyl]methyl]azanyl benzoate

Description:

[Imino[4-(4-morpholinylmethyl)phenyl]methyl]azanyl benzoate, identified by its CAS number 1255147-66-0, is a chemical compound characterized by its complex structure that includes an imino group, a morpholine moiety, and a benzoate functional group. This compound typically exhibits properties associated with both amines and esters, which may influence its solubility, reactivity, and potential biological activity. The presence of the morpholine ring suggests that it may have applications in medicinal chemistry, potentially acting as a pharmacophore due to its ability to interact with biological targets. Additionally, the benzoate portion may contribute to its stability and lipophilicity. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its behavior in various environments could be studied through methods such as spectroscopy and chromatography. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and other chemical applications.

Formula: C₁₉H₂₁N₃O₃

InChI: InChI=1S/C19H21N3O3/c20-18(21-25-19(23)17-4-2-1-3-5-17)16-8-6-15(7-9-16)14-22-10-12-24-13-11-22/h1-9H,10-14H2,(H2,20,21)

InChI key: InChIKey=GWYURXGMEYCYPZ-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(NOC(=O)C2=CC=CC=C2)=N)C=C1)N3CCOCC3

Synonyms:

• Benzoic acid, [imino[4-(4-morpholinylmethyl)phenyl]methyl]azanyl ester
• [Imino[4-(4-morpholinylmethyl)phenyl]methyl]azanyl benzoate