CAS 1255147-74-0
:Cyanamide, N-(2-amino-1,6-dihydro-6-oxo-4-pyrimidinyl)-
Description:
Cyanamide, N-(2-amino-1,6-dihydro-6-oxo-4-pyrimidinyl)-, identified by its CAS number 1255147-74-0, is a chemical compound that features a pyrimidine ring structure. This substance is characterized by the presence of both amino and carbonyl functional groups, which contribute to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The compound is of interest in various fields, including pharmaceuticals, due to its potential applications in medicinal chemistry and as a building block in the synthesis of other biologically active molecules. Its properties may include the ability to participate in hydrogen bonding and other intermolecular interactions, which can influence its behavior in biological systems. As with many nitrogen-containing compounds, it may also exhibit specific pharmacological effects, making it a subject of research in drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards.
Formula:C5H5N5O
InChI:InChI=1S/C5H5N5O/c6-2-8-3-1-4(11)10-5(7)9-3/h1H,(H4,7,8,9,10,11)
InChI key:InChIKey=VPKXFLUAGAEVHE-UHFFFAOYSA-N
SMILES:N(C#N)C1=CC(=O)N=C(N)N1
Synonyms:- Cyanamide, N-(2-amino-1,6-dihydro-6-oxo-4-pyrimidinyl)-
- N-(2-Amino-6-oxo-1,6-dihydro-4-pyrimidinyl)cyanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.