CAS 1255147-75-1

5-[3-Fluoro-5-(trifluoromethyl)phenoxy]-2-furancarboxylic acid

Description:

5-[3-Fluoro-5-(trifluoromethyl)phenoxy]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a phenoxy group substituted with a fluorine atom and a trifluoromethyl group. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, including potential aromaticity and stability due to the presence of the furan moiety. The trifluoromethyl group is known to enhance lipophilicity and influence biological activity, making this compound of interest in medicinal chemistry and agrochemical applications. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, potentially participating in hydrogen bonding and influencing solubility in polar solvents. Additionally, the fluorine substituents can affect the compound's reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups may contribute to its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₆F₄O₄

InChI: InChI=1S/C12H6F4O4/c13-7-3-6(12(14,15)16)4-8(5-7)19-10-2-1-9(20-10)11(17)18/h1-5H,(H,17,18)

InChI key: InChIKey=MRBYFFDOXJVZMS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(OC=2OC(C(O)=O)=CC2)=CC(F)=C1

Synonyms:

• 5-[3-Fluoro-5-(trifluoromethyl)phenoxy]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[3-fluoro-5-(trifluoromethyl)phenoxy]-