
CAS 125520-63-0
:1,2,5-Oxadiazole-3-carbonitrile, 4-phenyl-, 5-oxide
Description:
1,2,5-Oxadiazole-3-carbonitrile, 4-phenyl-, 5-oxide, with the CAS number 125520-63-0, is a heterocyclic organic compound characterized by its oxadiazole ring structure, which contains nitrogen and oxygen atoms. This compound features a carbonitrile group, contributing to its potential reactivity and applications in organic synthesis. The presence of a phenyl group enhances its aromatic properties, which can influence its stability and solubility in various solvents. As an oxide derivative, it may exhibit unique electronic properties, making it of interest in materials science and medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in chemical synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or found in specialized chemical databases. Overall, 1,2,5-Oxadiazole-3-carbonitrile, 4-phenyl-, 5-oxide represents a class of compounds that may offer diverse functional applications due to their unique structural characteristics.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c10-6-8-9(12(13)14-11-8)7-4-2-1-3-5-7/h1-5H
InChI key:InChIKey=WJOXYPNQASUCHB-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=N(=O)ON1)C2=CC=CC=C2
Synonyms:- 4-Cyano-3-phenylfuroxan
- 3-Phenyl-4-cyano-furoxan
- 1,2,5-Oxadiazole-3-carbonitrile, 4-phenyl-, 5-oxide
- Furazancarbonitrile, phenyl-, 5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
