CymitQuimica logo

CAS 1255206-70-2

:

4-Methyl-5-[(2R)-oxiran-2-yl]-2-benzofuran-1(3H)-one

Description:
4-Methyl-5-[(2R)-oxiran-2-yl]-2-benzofuran-1(3H)-one is a chemical compound characterized by its unique structural features, which include a benzofuran moiety and an epoxide group. The presence of the methyl group at the 4-position and the oxirane ring at the 5-position contributes to its reactivity and potential biological activity. This compound may exhibit properties typical of both benzofurans and epoxides, such as potential antioxidant or antimicrobial activities. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic attacks due to the strained epoxide ring. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, its specific stereochemistry, indicated by the (2R) configuration of the oxirane, may play a crucial role in its biological interactions and pharmacological properties. Overall, 4-Methyl-5-[(2R)-oxiran-2-yl]-2-benzofuran-1(3H)-one represents a fascinating subject for further research in both chemical synthesis and potential therapeutic applications.
Formula:C11H10O3
InChI:InChI=1S/C11H10O3/c1-6-7(10-5-13-10)2-3-8-9(6)4-14-11(8)12/h2-3,10H,4-5H2,1H3/t10-/m0/s1
InChI key:InChIKey=YQLAZVRXBCSLAI-JTQLQIEISA-N
SMILES:CC1=C2C(=CC=C1[C@@H]3CO3)C(=O)OC2
Synonyms:
  • 4-Methyl-5-[(2R)-oxiran-2-yl]-2-benzofuran-1(3H)-one
  • 4-Methyl-5-(2R)-2-oxiranyl-1(3H)-isobenzofuranone
  • 1(3H)-Isobenzofuranone, 4-methyl-5-(2R)-2-oxiranyl-
  • 4-Methyl-5-((2R)-oxiran-2-yl)-2-benzofuran-1(3H)-one
  • (R)-4-Methyl-5-(oxiran-2-yl)isobenzofuran-1(3H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.