CAS 1255206-86-0
:3-Bromo-2,4-dimethylbenzenemethanol
Description:
3-Bromo-2,4-dimethylbenzenemethanol is an organic compound characterized by its aromatic structure, which includes a bromine substituent and two methyl groups on a benzene ring, along with a hydroxymethyl group (-CH2OH) attached to the aromatic system. This compound is part of the class of alcohols due to the presence of the hydroxymethyl group, which contributes to its reactivity and potential for hydrogen bonding. The bromine atom introduces a halogen functionality, which can influence the compound's reactivity, making it a potential candidate for nucleophilic substitution reactions. The presence of the methyl groups can affect the steric hindrance and electronic properties of the molecule, impacting its solubility and interaction with other chemical species. Additionally, the compound may exhibit various physical properties such as boiling point, melting point, and solubility, which are influenced by its molecular structure. Overall, 3-Bromo-2,4-dimethylbenzenemethanol is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-6-3-4-8(5-11)7(2)9(6)10/h3-4,11H,5H2,1-2H3
InChI key:InChIKey=WFKBMZPIDSRCCV-UHFFFAOYSA-N
SMILES:C(O)C1=C(C)C(Br)=C(C)C=C1
Synonyms:- (3-Bromo-2,4-dimethylphenyl)methanol
- 3-Bromo-2,4-dimethylbenzenemethanol
- Benzenemethanol, 3-bromo-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.