
CAS 1255209-16-5
:3-Bromo-2-methoxybenzeneethanol
Description:
3-Bromo-2-methoxybenzeneethanol, identified by its CAS number 1255209-16-5, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a benzene ring, along with a hydroxyl group (alcohol) at the ethyl position. This compound typically exhibits a polar nature due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water. The bromine substituent may impart certain reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy group can also affect the electronic properties of the benzene ring, potentially enhancing its reactivity towards electrophiles. In terms of physical properties, compounds of this type often have moderate boiling points and melting points, influenced by molecular weight and intermolecular forces. Overall, 3-Bromo-2-methoxybenzeneethanol is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, depending on its specific reactivity and functional properties.
Formula:C9H11BrO2
InChI:InChI=1S/C9H11BrO2/c1-12-9-7(5-6-11)3-2-4-8(9)10/h2-4,11H,5-6H2,1H3
InChI key:InChIKey=UIQXAGMECWHMHC-UHFFFAOYSA-N
SMILES:C(CO)C1=C(OC)C(Br)=CC=C1
Synonyms:- 3-Bromo-2-methoxybenzeneethanol
- 2-(3-Bromo-2-methoxyphenyl)ethanol
- 2-(3-Bromo-2-methoxyphenyl)ethan-1-ol
- Benzeneethanol, 3-bromo-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.