
CAS 125537-14-6
:1,1′-[1,4-Cyclohexanediylbis(methylene)] diheptanoate
Description:
1,1′-[1,4-Cyclohexanediylbis(methylene)] diheptanoate, with the CAS number 125537-14-6, is an organic compound characterized by its structure, which features a cyclohexane ring connected by methylene groups to two heptanoate chains. This compound is a diester, indicating that it contains two ester functional groups derived from heptanoic acid. The presence of the cyclohexane moiety contributes to its rigidity and influences its physical properties, such as melting and boiling points. Typically, compounds like this may exhibit low solubility in water due to their hydrophobic heptanoate chains, while being more soluble in organic solvents. The diheptanoate structure suggests potential applications in fields such as materials science, where it may serve as a plasticizer or in the formulation of surfactants. Additionally, the compound's unique structure may impart specific characteristics such as thermal stability and mechanical strength, making it of interest in various industrial applications. However, detailed studies would be necessary to fully understand its reactivity and potential uses.
Formula:C22H40O4
InChI:InChI=1S/C22H40O4/c1-3-5-7-9-11-21(23)25-17-19-13-15-20(16-14-19)18-26-22(24)12-10-8-6-4-2/h19-20H,3-18H2,1-2H3
InChI key:InChIKey=MHUFBTKJDDDEBA-UHFFFAOYSA-N
SMILES:C(OC(CCCCCC)=O)C1CCC(COC(CCCCCC)=O)CC1
Synonyms:- 1,1′-[1,4-Cyclohexanediylbis(methylene)] diheptanoate
- Heptanoic acid, 1,1′-[1,4-cyclohexanediylbis(methylene)] ester
- Heptanoic acid, 1,4-cyclohexanediylbis(methylene) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Heptanoic acid, 1,1'-[1,4-cyclohexanediylbis(methylene)] ester
CAS:Formula:C22H40O4Molecular weight:368.5506
