CymitQuimica logo

CAS 1255574-38-9

:

2,5-Difluoro-4-(1H-tetrazol-1-yl)phenol

Description:
2,5-Difluoro-4-(1H-tetrazol-1-yl)phenol is an organic compound characterized by the presence of a phenolic structure substituted with two fluorine atoms and a tetrazole group. The fluorine substituents are located at the 2 and 5 positions of the phenol ring, which can influence the compound's electronic properties and reactivity. The tetrazole moiety, a five-membered ring containing four nitrogen atoms, is known for its stability and ability to participate in various chemical reactions, including coordination with metals and formation of energetic materials. This compound may exhibit interesting biological activities due to the presence of both the phenolic and tetrazole functionalities, making it a candidate for pharmaceutical research. Additionally, the presence of fluorine can enhance lipophilicity and metabolic stability, which are desirable traits in drug design. Overall, 2,5-Difluoro-4-(1H-tetrazol-1-yl)phenol presents a unique combination of structural features that may lead to diverse applications in medicinal chemistry and materials science.
Formula:C7H4F2N4O
InChI:InChI=1S/C7H4F2N4O/c8-4-2-7(14)5(9)1-6(4)13-3-10-11-12-13/h1-3,14H
InChI key:InChIKey=GEAURNZYUSYOAH-UHFFFAOYSA-N
SMILES:FC1=C(C=C(F)C(O)=C1)N2C=NN=N2
Synonyms:
  • Phenol, 2,5-difluoro-4-(1H-tetrazol-1-yl)-
  • 2,5-Difluoro-4-(1H-tetrazol-1-yl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.