CAS 1255574-39-0
:Phenylmethyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate
Description:
Phenylmethyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate is a synthetic organic compound characterized by its unique structural features, which include a phenylmethyl group and a cyclopropyl moiety substituted with a chlorophenyl group. This compound belongs to the class of carbamates, which are esters or salts of carbamic acid, and are known for their diverse biological activities. The presence of the chlorophenyl group may impart specific electronic and steric properties, potentially influencing its reactivity and interaction with biological targets. The cyclopropyl ring adds to the compound's rigidity and may affect its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as solubility, stability, and biological activity, would depend on the compound's molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C17H16ClNO2
InChI:InChI=1S/C17H16ClNO2/c18-15-8-4-7-14(11-15)17(9-10-17)19-16(20)21-12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,19,20)
InChI key:InChIKey=NTLIQLRJAQUQTM-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2(CC2)C3=CC(Cl)=CC=C3
Synonyms:- Phenylmethyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate
- Carbamic acid, N-[1-(3-chlorophenyl)cyclopropyl]-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
