CAS 1255574-45-8

Quinoline, 6,8-dimethyl-, hydrochloride (1:1)

Description:

Quinoline, 6,8-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic compound containing a pyridine ring fused to a benzene ring. The presence of two methyl groups at the 6 and 8 positions of the quinoline structure contributes to its unique properties, including its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals and research. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its CAS number, 1255574-45-8, allows for precise identification in chemical databases. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential toxicity or reactivity. Overall, Quinoline, 6,8-dimethyl-, hydrochloride (1:1) represents a significant compound in the field of organic chemistry and drug development.

Formula: C₁₁H₁₁N·ClH

InChI: InChI=1S/C11H11N.ClH/c1-8-6-9(2)11-10(7-8)4-3-5-12-11;/h3-7H,1-2H3;1H

InChI key: InChIKey=URHCKNOJIHABGM-UHFFFAOYSA-N

SMILES: CC=1C2=C(C=C(C)C1)C=CC=N2.Cl

Synonyms:

• Quinoline, 6,8-dimethyl-, hydrochloride (1:1)

6,8-Dimethylquinoline, HCl

CAS: 1255574-45-8

Formula: C₁₁H₁₂ClN

Molecular weight: 193.6727

Ref: IN-DA000NUH

6,8-Dimethylquinoline hydrochloride

CAS: 1255574-45-8

6,8-Dimethylquinoline hydrochloride

Purity: 96%

Molecular weight: 193.67g/mol

Ref: 54-OR901724