CAS 1255574-46-9
:2-Piperidinone, 1-(5-bromo-2-fluorophenyl)-
Description:
2-Piperidinone, 1-(5-bromo-2-fluorophenyl)-, with the CAS number 1255574-46-9, is a chemical compound characterized by its piperidinone core structure, which features a six-membered ring containing a nitrogen atom and a carbonyl group. This compound is notable for the presence of a 5-bromo-2-fluorophenyl substituent, which introduces halogen atoms that can influence its reactivity and biological activity. Typically, such compounds may exhibit properties relevant to medicinal chemistry, potentially serving as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients themselves. The presence of the bromine and fluorine substituents can enhance lipophilicity and alter the electronic properties of the molecule, affecting its interaction with biological targets. Additionally, the compound may exhibit specific solubility characteristics and stability under various conditions, which are important for its application in research and development. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C11H11BrFNO
InChI:InChI=1S/C11H11BrFNO/c12-8-4-5-9(13)10(7-8)14-6-2-1-3-11(14)15/h4-5,7H,1-3,6H2
InChI key:InChIKey=NIQQIWOAWGBHOH-UHFFFAOYSA-N
SMILES:FC1=C(C=C(Br)C=C1)N2C(=O)CCCC2
Synonyms:- 1-(5-Bromo-2-fluorophenyl)piperidin-2-one
- 2-Piperidinone, 1-(5-bromo-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
