CAS 1255574-49-2
:5-(4-Formylphenyl)-3-pyridinecarbonitrile
Description:
5-(4-Formylphenyl)-3-pyridinecarbonitrile is an organic compound characterized by its unique structural features, which include a pyridine ring and a formylphenyl group. The presence of the formyl group (-CHO) indicates that it can participate in various chemical reactions, such as condensation and reduction, making it a versatile intermediate in organic synthesis. The cyano group (-C≡N) attached to the pyridine ring contributes to the compound's reactivity, allowing for potential applications in the synthesis of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for hydrogen bonding and π-π interactions, which can influence its physical properties, such as melting point and boiling point. Additionally, the compound's functional groups may impart specific electronic properties, making it of interest in materials science and medicinal chemistry. Overall, 5-(4-Formylphenyl)-3-pyridinecarbonitrile is a compound with significant potential for further research and application in various chemical fields.
Formula:C13H8N2O
InChI:InChI=1S/C13H8N2O/c14-6-11-5-13(8-15-7-11)12-3-1-10(9-16)2-4-12/h1-5,7-9H
InChI key:InChIKey=CNRZLMIBTWWUGG-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=C(C=O)C=C2
Synonyms:- 3-Pyridinecarbonitrile, 5-(4-formylphenyl)-
- 5-(4-Formylphenyl)-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
