CAS 1255574-57-2
:3-Methyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-2,3,5(4H)-tricarboxylate
Description:
3-Methyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-2,3,5(4H)-tricarboxylate is a complex organic compound characterized by its unique pyrazolo structure, which incorporates both methyl and nitrophenyl substituents. This compound features multiple carboxylate groups, contributing to its potential acidity and reactivity. The presence of the nitrophenyl group suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the electron-withdrawing nature of the nitro group, which can influence the compound's electronic properties and biological activity. The dihydropyrazine moiety may also impart specific stereochemical characteristics, affecting its interactions with biological targets. Additionally, the compound's solubility and stability can be influenced by the presence of the carboxylate groups, making it a candidate for various chemical reactions and applications in organic synthesis. Overall, this compound's structural features suggest a diverse range of potential applications in both research and industry, particularly in fields related to drug development and materials science.
Formula:C17H16N4O8
InChI:InChI=1S/C17H16N4O8/c1-28-16(24)13-12-8-19(6-7-20(12)18-14(13)15(22)23)17(25)29-9-10-2-4-11(5-3-10)21(26)27/h2-5H,6-9H2,1H3,(H,22,23)
InChI key:InChIKey=DGRBRZWMVATJNJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(N=C1C(O)=O)CCN(C(OCC3=CC=C(N(=O)=O)C=C3)=O)C2
Synonyms:- 3-Methyl 5-[(4-nitrophenyl)methyl] 6,7-dihydropyrazolo[1,5-a]pyrazine-2,3,5(4H)-tricarboxylate
- Pyrazolo[1,5-a]pyrazine-2,3,5(4H)-tricarboxylic acid, 6,7-dihydro-, 3-methyl 5-[(4-nitrophenyl)methyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Methoxycarbonyl)-5-((4-nitrobenzyloxy)carbonyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxylic acid
CAS:Formula:C17H16N4O8Molecular weight:404.3309
