CAS 1255574-61-8
:4-Bromo-5-(3-methylbutoxy)-2-nitrobenzenamine
Description:
4-Bromo-5-(3-methylbutoxy)-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and an amine functional group. The presence of the bromine atom contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic substitution. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. The 3-methylbutoxy substituent adds hydrophobic characteristics, potentially affecting the compound's solubility in different solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential uses in the synthesis of other chemical entities or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many brominated and nitro-substituted compounds, due to potential toxicity and environmental concerns. Overall, 4-Bromo-5-(3-methylbutoxy)-2-nitrobenzenamine represents a versatile compound within the realm of organic chemistry.
Formula:C11H15BrN2O3
InChI:InChI=1S/C11H15BrN2O3/c1-7(2)3-4-17-11-6-9(13)10(14(15)16)5-8(11)12/h5-7H,3-4,13H2,1-2H3
InChI key:InChIKey=YWBRNGDBCRWWLK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)C=C(OCCC(C)C)C(Br)=C1
Synonyms:- 4-Bromo-5-(3-methylbutoxy)-2-nitrobenzenamine
- Benzenamine, 4-bromo-5-(3-methylbutoxy)-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
