CAS 1255574-62-9
:Phenylmethyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate
Description:
Phenylmethyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate, identified by its CAS number 1255574-62-9, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group and a cyclopropyl moiety, which contributes to its unique structural characteristics. The presence of a fluorophenyl group indicates that it may exhibit specific electronic properties due to the electronegative fluorine atom, potentially influencing its reactivity and biological activity. Carbamates are known for their applications in various fields, including pharmaceuticals and agrochemicals, often acting as inhibitors or modulators of biological processes. The compound's molecular structure suggests potential interactions with biological targets, which could be of interest in medicinal chemistry. Additionally, the cyclopropyl ring may impart strain and unique conformational properties, affecting the compound's stability and reactivity. Overall, the characteristics of this compound make it a subject of interest for further research, particularly in the context of drug development and chemical synthesis.
Formula:C17H16FNO2
InChI:InChI=1S/C17H16FNO2/c18-15-8-6-14(7-9-15)17(10-11-17)19-16(20)21-12-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,19,20)
InChI key:InChIKey=IGJYPXXIOMBUNS-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2(CC2)C3=CC=C(F)C=C3
Synonyms:- Carbamic acid, N-[1-(4-fluorophenyl)cyclopropyl]-, phenylmethyl ester
- Phenylmethyl N-[1-(4-fluorophenyl)cyclopropyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
