CymitQuimica logo

CAS 1255574-64-1

:

1-(1,1-Dimethylethyl) 2,3-dihydro-2-(2-propen-1-yl)-1H-benzimidazole-1,2-dicarboxylate

Description:
1-(1,1-Dimethylethyl) 2,3-dihydro-2-(2-propen-1-yl)-1H-benzimidazole-1,2-dicarboxylate, with the CAS number 1255574-64-1, is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with various functional groups. This compound features a dicarboxylate moiety, indicating the presence of two carboxylic acid groups, which can influence its reactivity and solubility. The presence of a 1,1-dimethylethyl group contributes to its steric bulk, potentially affecting its interactions with other molecules. Additionally, the propenyl group suggests that the compound may participate in various chemical reactions, including polymerization or addition reactions. Its dihydro form indicates partial saturation, which may impact its stability and reactivity. Overall, this compound may exhibit interesting biological or pharmacological properties, making it a subject of interest in medicinal chemistry and related fields. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H20N2O4
InChI:InChI=1S/C16H20N2O4/c1-5-10-16(13(19)20)17-11-8-6-7-9-12(11)18(16)14(21)22-15(2,3)4/h5-9,17H,1,10H2,2-4H3,(H,19,20)
InChI key:InChIKey=CRQAWJMUMHLQEO-UHFFFAOYSA-N
SMILES:C(C=C)C1(C(O)=O)N(C(OC(C)(C)C)=O)C=2C(N1)=CC=CC2
Synonyms:
  • 1-(1,1-Dimethylethyl) 2,3-dihydro-2-(2-propen-1-yl)-1H-benzimidazole-1,2-dicarboxylate
  • 1H-Benzimidazole-1,2-dicarboxylic acid, 2,3-dihydro-2-(2-propen-1-yl)-, 1-(1,1-dimethylethyl) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.