CAS 1255574-65-2
:1,3-Bis(1,1-dimethylethyl) 2-(3,4-difluorophenyl)imidodicarbonate
Description:
1,3-Bis(1,1-dimethylethyl) 2-(3,4-difluorophenyl)imidodicarbonate, with CAS number 1255574-65-2, is a chemical compound characterized by its unique structure that includes an imidodicarbonate functional group. This compound features two bulky tert-butyl groups, which contribute to its steric hindrance, potentially influencing its reactivity and solubility. The presence of the 3,4-difluorophenyl moiety introduces fluorine atoms, which can enhance the compound's lipophilicity and alter its electronic properties, making it of interest in various chemical applications. Imidodicarbonates are known for their utility in organic synthesis, particularly in the formation of carbamates and ureas. The compound's stability, reactivity, and potential applications in pharmaceuticals or agrochemicals may be influenced by its structural characteristics. Additionally, the presence of fluorine can impart unique properties, such as increased metabolic stability or altered binding affinity in biological systems. Overall, this compound represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and applications.
Formula:C16H21F2NO4
InChI:InChI=1S/C16H21F2NO4/c1-15(2,3)22-13(20)19(14(21)23-16(4,5)6)10-7-8-11(17)12(18)9-10/h7-9H,1-6H3
InChI key:InChIKey=OAUWBPIKAQYWJI-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(C(OC(C)(C)C)=O)C1=CC(F)=C(F)C=C1
Synonyms:- 1,3-Bis(1,1-dimethylethyl) 2-(3,4-difluorophenyl)imidodicarbonate
- Imidodicarbonic acid, 2-(3,4-difluorophenyl)-, 1,3-bis(1,1-dimethylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
