CAS 1255574-67-4
:1,1-Dimethylethyl 1,3-dihydrospiro[2H-indole-2,3′-pyrrolidine]-1′-carboxylate
Description:
1,1-Dimethylethyl 1,3-dihydrospiro[2H-indole-2,3′-pyrrolidine]-1′-carboxylate, identified by its CAS number 1255574-67-4, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of indole and pyrrolidine. This compound typically features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its interactions in biological systems and chemical reactions. The spiro configuration often imparts interesting conformational characteristics, potentially affecting its pharmacological activity. While specific physical properties such as melting point, boiling point, and solubility may vary, compounds of this nature are often studied for their potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of chemical behavior and potential applications in various fields of research.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c1-15(2,3)20-14(19)18-9-8-16(11-18)10-12-6-4-5-7-13(12)17-16/h4-7,17H,8-11H2,1-3H3
InChI key:InChIKey=WOICJXSOFFVKPZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(CC=3C(N2)=CC=CC3)CC1
Synonyms:- Spiro[2H-indole-2,3′-pyrrolidine]-1′-carboxylic acid, 1,3-dihydro-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 1,3-dihydrospiro[2H-indole-2,3′-pyrrolidine]-1′-carboxylate
- tert-Butyl spiro[indoline-2,3'
- tert-Butyl spiro[indoline-2,3'-pyrrolidine]-1'-carboxylate
- tert-butyl spiro[1,3-dihydroindole-2,3'-pyrrolidine]-1'-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl spiro[indoline-2,3'-pyrrolidine]-1'-carboxylate
CAS:Formula:C16H22N2O2Molecular weight:274.3581
