
CAS 1255574-68-5
:Quinoline, 8-bromo-6-methyl-, hydrochloride (1:1)
Description:
Quinoline, 8-bromo-6-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a bromine atom at the 8-position and a methyl group at the 6-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential applications in the synthesis of other organic compounds or as a precursor in various chemical reactions. The presence of the bromine substituent can also influence its electronic properties, potentially affecting its interactions with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Quinoline, 8-bromo-6-methyl-, hydrochloride (1:1) is a notable compound in the realm of organic chemistry with implications in research and development.
Formula:C10H8BrN·ClH
InChI:InChI=1S/C10H8BrN.ClH/c1-7-5-8-3-2-4-12-10(8)9(11)6-7;/h2-6H,1H3;1H
InChI key:InChIKey=XIBMEDNZAUEGDZ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(C)C1)C=CC=N2.Cl
Synonyms:- Quinoline, 8-bromo-6-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
