CAS 1255574-72-1
:1-Bromo-2,4-dichloro-5-(trifluoromethoxy)benzene
Description:
1-Bromo-2,4-dichloro-5-(trifluoromethoxy)benzene is an aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features a bromine atom, two chlorine atoms, and a trifluoromethoxy group, which significantly influence its chemical properties and reactivity. The presence of these electronegative halogens contributes to the compound's overall polarity and can enhance its reactivity in nucleophilic substitution reactions. The trifluoromethoxy group, in particular, is known for its strong electron-withdrawing effects, which can stabilize negative charges in reaction intermediates. This compound is likely to be a solid at room temperature and may exhibit low solubility in water due to its hydrophobic aromatic structure, while being more soluble in organic solvents. Its unique combination of substituents may also impart specific biological activity or environmental persistence, making it of interest in fields such as agrochemicals or materials science. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health and environmental risks.
Formula:C7H2BrCl2F3O
InChI:InChI=1S/C7H2BrCl2F3O/c8-3-1-6(14-7(11,12)13)5(10)2-4(3)9/h1-2H
InChI key:InChIKey=KKUZNWGBIDSKRE-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(Cl)C=C(Cl)C(Br)=C1
Synonyms:- 1-Bromo-2,4-dichloro-5-(trifluoromethoxy)benzene
- Benzene, 1-bromo-2,4-dichloro-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
