CymitQuimica logo

CAS 125559-75-3

:

N-(1-Oxopentyl)-L-cysteine

Description:
N-(1-Oxopentyl)-L-cysteine is a chemical compound characterized by its structure, which includes a cysteine amino acid backbone modified with a pentyl chain and a ketone functional group. This compound features a thiol (-SH) group, which is typical of cysteine, allowing for potential redox reactions and the formation of disulfide bonds. The presence of the oxopentyl group suggests that it may participate in various biochemical pathways, possibly influencing protein interactions or enzyme activities. Its molecular structure contributes to its solubility properties, likely making it soluble in polar solvents. The compound may also exhibit biological activity, potentially serving as a precursor in the synthesis of other biologically relevant molecules or as a modulator in metabolic processes. As with many cysteine derivatives, it may play a role in antioxidant defense mechanisms due to the reactivity of the thiol group. However, specific applications and biological effects would depend on further empirical studies and context within biochemical systems.
Formula:C8H15NO3S
InChI:InChI=1S/C8H15NO3S/c1-2-3-4-7(10)9-6(5-13)8(11)12/h6,13H,2-5H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1
InChI key:InChIKey=ZUMRUBKOLDJEJN-LURJTMIESA-N
SMILES:[C@@H](NC(CCCC)=O)(C(O)=O)CS
Synonyms:
  • L-Cysteine, N-(1-oxopentyl)-
  • N-(1-Oxopentyl)-L-cysteine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.