CAS 1255636-18-0

3-Pyridinol, 6-(2-methylphenyl)-

Description:

3-Pyridinol, 6-(2-methylphenyl)- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The compound features a hydroxyl group (-OH) at the 3-position of the pyridine ring, contributing to its classification as a pyridinol. The presence of a 2-methylphenyl group at the 6-position introduces additional hydrophobic characteristics and influences its chemical reactivity and potential biological activity. This compound may exhibit properties typical of both pyridines and phenolic compounds, such as potential antioxidant activity or interactions with biological targets. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, affecting its solubility and reactivity in various solvents. The specific applications and behavior of 3-Pyridinol, 6-(2-methylphenyl)- would depend on its interactions in chemical reactions and its role in biological systems, making it of interest in medicinal chemistry and material science.

Formula: C₁₂H₁₁NO

InChI: InChI=1S/C12H11NO/c1-9-4-2-3-5-11(9)12-7-6-10(14)8-13-12/h2-8,14H,1H3

InChI key: InChIKey=AOEXBAOXFVGATH-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC=C(O)C=N2)C=CC=C1

Synonyms:

• 3-Pyridinol, 6-(2-methylphenyl)-