CAS 1255638-36-8

3-Pyridinol, 6-(2-methoxyphenyl)-

Description:

3-Pyridinol, 6-(2-methoxyphenyl)- is an organic compound characterized by its pyridine ring structure, which features a hydroxyl group (-OH) at the 3-position and a 2-methoxyphenyl group at the 6-position. This compound belongs to the class of pyridines, which are known for their aromatic properties and basicity due to the nitrogen atom in the ring. The presence of the methoxy group (-OCH3) on the phenyl ring enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1S/C12H11NO2/c1-15-12-5-3-2-4-10(12)11-7-6-9(14)8-13-11/h2-8,14H,1H3

InChI key: InChIKey=RSWPDQFILREJAD-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)C2=CC=C(O)C=N2

Synonyms:

• 3-Pyridinol, 6-(2-methoxyphenyl)-

5-Hydroxy-2-(2-methoxyphenyl)pyridine

CAS: 1255638-36-8

Formula: C₁₂H₁₁NO₂

Molecular weight: 201.2212

Ref: IN-DA000NW0

5-Hydroxy-2-(2-methoxyphenyl)pyridine

CAS: 1255638-36-8

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO₂

Purity: Min. 95%

Molecular weight: 201.22 g/mol

Ref: 3D-FAC63836