CAS 1255666-26-2

8-(1,1-Dimethylethyl) 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate

Description:

8-(1,1-Dimethylethyl) 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring two nitrogen atoms in the diaza positions. This compound is notable for its dicarboxylate functional groups, which can influence its reactivity and solubility in various solvents. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, potentially affecting its interactions with other molecules and its overall stability. The spiro structure often imparts interesting conformational properties, which can be relevant in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, making it of interest for pharmaceutical applications. Its CAS number, 1255666-26-2, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses in scientific literature and databases. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₄H₂₄N₂O₄

InChI: InChI=1S/C14H24N2O4/c1-13(2,3)20-12(19)16-6-4-14(5-7-16)8-10(11(17)18)15-9-14/h10,15H,4-9H2,1-3H3,(H,17,18)

InChI key: InChIKey=VCWDXMPEVSUFHI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2(CCN(C(OC(C)(C)C)=O)CC2)CN1

Synonyms:

• 2,8-Diazaspiro[4.5]decane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) ester
• 8-(1,1-Dimethylethyl) 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate