
CAS 125568-72-1
:Benzoic acid, 2,4,6-trifluoro-3-nitro-, methyl ester
Description:
Benzoic acid, 2,4,6-trifluoro-3-nitro-, methyl ester, with the CAS number 125568-72-1, is an organic compound characterized by the presence of a benzoic acid moiety modified with trifluoro and nitro substituents. This compound features a methyl ester functional group, which enhances its solubility in organic solvents. The trifluoromethyl groups contribute to its lipophilicity and can influence its reactivity and biological activity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and reactivity in various chemical reactions. Typically, such compounds exhibit interesting properties, including potential applications in pharmaceuticals, agrochemicals, and materials science due to their unique electronic characteristics. Additionally, the presence of fluorine atoms often imparts enhanced stability and altered physical properties, making these compounds of interest in various fields of research. Safety and handling considerations are essential, as with many fluorinated and nitro compounds, due to potential toxicity and environmental impact.
Formula:C8H4F3NO4
InChI:InChI=1S/C8H4F3NO4/c1-16-8(13)5-3(9)2-4(10)7(6(5)11)12(14)15/h2H,1H3
InChI key:InChIKey=XBZIDFOCYQIFNP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(F)C(N(=O)=O)=C(F)C=C1F
Synonyms:- Benzoic acid, 2,4,6-trifluoro-3-nitro-, methyl ester
- Methyl 2,4,6-trifluoro-3-nitrobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.