CAS 1255717-00-0

2-Piperazinone, 1-ethyl-3-methyl-, hydrobromide (1:1)

Description:

2-Piperazinone, 1-ethyl-3-methyl-, hydrobromide (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group attached to the piperazine ring, contributing to its unique properties. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrobromide indicates that it can form ionic interactions, which may influence its biological activity and stability. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of central nervous system activity. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₁₄N₂O·BrH

InChI: InChI=1S/C7H14N2O.BrH/c1-3-9-5-4-8-6(2)7(9)10;/h6,8H,3-5H2,1-2H3;1H

InChI key: InChIKey=VZHRVHYNMLGLPC-UHFFFAOYSA-N

SMILES: C(C)N1C(=O)C(C)NCC1.Br

Synonyms:

• 2-Piperazinone, 1-ethyl-3-methyl-, hydrobromide (1:1)

1-ethyl-3-methyl-2-piperazinone hydrobromide

CAS: 1255717-00-0

Formula: C₇H₁₅BrN₂O

Purity: 95.0%

Molecular weight: 223.114

Ref: 10-F358954