CAS 1255717-08-8

3-Isoxazolemethanamine, 5-cyclopropyl-, hydrochloride (1:1)

Description:

3-Isoxazolemethanamine, 5-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and potential biological activity. The presence of the cyclopropyl group enhances its structural complexity and may influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including medicinal chemistry. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific interactions with biological targets, making it of interest in pharmaceutical research. Its molecular structure suggests potential for various functional groups that could participate in chemical reactions or biological interactions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including stability, reactivity, and biological effects.

Formula: C₇H₁₀N₂O·ClH

InChI: InChI=1S/C7H10N2O.ClH/c8-4-6-3-7(10-9-6)5-1-2-5;/h3,5H,1-2,4,8H2;1H

InChI key: InChIKey=KESPLEVQOQAPRT-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(ON1)C2CC2.Cl

Synonyms:

• 3-Isoxazolemethanamine, 5-cyclopropyl-, hydrochloride (1:1)