CAS 1255717-16-8

4H-1,2,4-Triazole-3-methanamine, α-methyl-4-propyl-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, α-methyl-4-propyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential antifungal and antimicrobial activities, making it of interest in pharmaceutical applications. The presence of the α-methyl and propyl groups suggests that it may have specific steric and electronic properties that influence its biological activity and solubility. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which is advantageous for formulation in various applications. The compound's CAS number, 1255717-16-8, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound's unique structural features and potential biological activities make it a subject of interest in medicinal chemistry and drug development.

Formula: C₇H₁₄N₄·2ClH

InChI: InChI=1S/C7H14N4.2ClH/c1-3-4-11-5-9-10-7(11)6(2)8;;/h5-6H,3-4,8H2,1-2H3;2*1H

InChI key: InChIKey=FOUIXVIFXXONEL-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N(CCC)C=NN1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, α-methyl-4-propyl-, hydrochloride (1:2)

[1-(4-propyl-4H-1,2,4-triazol-3-yl)ethyl]amine dihydrochloride

CAS: 1255717-16-8

Formula: C₇H₁₆Cl₂N₄

Purity: 95.0%

Molecular weight: 227.13

Ref: 10-F359420