CAS 1255717-22-6

Piperidine, 2-(2-bromoethyl)-1-methyl-, hydrobromide (1:1)

Description:

Piperidine, 2-(2-bromoethyl)-1-methyl-, hydrobromide (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromoethyl group at the 2-position and a methyl group at the 1-position contributes to its unique reactivity and properties. As a hydrobromide salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular interactions can be influenced by the bromine atom, which can participate in nucleophilic substitution reactions. The hydrobromide form suggests that it can act as a proton donor, potentially affecting its behavior in various chemical environments. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, this compound's structure and functional groups make it a subject of interest for further research and application in synthetic chemistry.

Formula: C₈H₁₆BrN·BrH

InChI: InChI=1S/C8H16BrN.BrH/c1-10-7-3-2-4-8(10)5-6-9;/h8H,2-7H2,1H3;1H

InChI key: InChIKey=PYOYPRZOFTXHRE-UHFFFAOYSA-N

SMILES: C(CBr)C1N(C)CCCC1.Br

Synonyms:

• Piperidine, 2-(2-bromoethyl)-1-methyl-, hydrobromide (1:1)

2-(2-bromoethyl)-1-methylpiperidine hydrobromide

CAS: 1255717-22-6

Formula: C₈H₁₇Br₂N

Purity: 95.0%

Molecular weight: 287.039

Ref: 10-F359819