CymitQuimica logo

CAS 1255717-29-3

:

1,2,4-Oxadiazole-5-methanamine, 3-ethyl-α-methyl-, 2,2,2-trifluoroacetate (1:1)

Description:
1,2,4-Oxadiazole-5-methanamine, 3-ethyl-α-methyl-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanamine group, which contributes to its amine functionality, and an ethyl group that enhances its hydrophobic characteristics. The presence of the trifluoroacetate moiety indicates that it has significant fluorine content, which can impart unique electronic properties and increase lipophilicity. The combination of these functional groups suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of biologically active compounds. The compound's molecular structure may influence its solubility, stability, and reactivity, making it of interest for further research in synthetic chemistry and material science. Additionally, the specific CAS number allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in various fields.
Formula:C6H11N3O·C2HF3O2
InChI:InChI=1S/C6H11N3O.C2HF3O2/c1-3-5-8-6(4(2)7)10-9-5;3-2(4,5)1(6)7/h4H,3,7H2,1-2H3;(H,6,7)
InChI key:InChIKey=DMUDJJQKSFZITG-UHFFFAOYSA-N
SMILES:C(C)(N)C1=NC(CC)=NO1.C(C(O)=O)(F)(F)F
Synonyms:
  • 1,2,4-Oxadiazole-5-methanamine, 3-ethyl-α-methyl-, 2,2,2-trifluoroacetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.