CAS 1255717-30-6

1,2,4-Oxadiazole-5-methanamine, 3-(2-pyridinyl)-, 2,2,2-trifluoroacetate (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-(2-pyridinyl)-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its oxadiazole ring, which contributes to its heterocyclic structure and potential biological activity. The presence of a pyridine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The trifluoroacetate group enhances its solubility and stability, while also influencing its reactivity and potential applications in various chemical reactions. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, typical of many oxadiazole derivatives. Its molecular structure allows for diverse interactions, which can be exploited in drug design and development. The CAS number 1255717-30-6 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, the combination of the oxadiazole and pyridine functionalities, along with the trifluoroacetate group, positions this compound as a potentially valuable entity in pharmaceutical research and development.

Formula: C₈H₈N₄O·C₂HF₃O₂

InChI: InChI=1S/C8H8N4O.C2HF3O2/c9-5-7-11-8(12-13-7)6-3-1-2-4-10-6;3-2(4,5)1(6)7/h1-4H,5,9H2;(H,6,7)

InChI key: InChIKey=MRJWULRQWTYKKF-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=NO1)C2=CC=CC=N2.C(C(O)=O)(F)(F)F

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-(2-pyridinyl)-, 2,2,2-trifluoroacetate (1:1)

{[3-(2-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl}amine trifluoroacetate

CAS: 1255717-30-6

Formula: C₁₀H₉F₃N₄O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 290.202

Ref: 10-F359202