CAS 1255717-31-7

4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance is typically encountered as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the methanamine and methoxyethyl groups suggests that it may have functional properties relevant to biological activity, potentially influencing its solubility, reactivity, and interaction with biological systems. The compound may be of interest in pharmaceutical research, particularly in the development of agents with antifungal or antimicrobial properties, given the known activities of triazole derivatives. Its molecular structure allows for various interactions, making it a candidate for further studies in medicinal chemistry. As with many chemical substances, safety data and handling precautions should be observed, particularly due to the presence of nitrogen-containing functional groups that may have specific reactivity profiles.

Formula: C₆H₁₂N₄O·2ClH

InChI: InChI=1S/C6H12N4O.2ClH/c1-11-3-2-10-5-8-9-6(10)4-7;;/h5H,2-4,7H2,1H3;2*1H

InChI key: InChIKey=PNNLJKZODMGWGK-UHFFFAOYSA-N

SMILES: C(COC)N1C(CN)=NN=C1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-, hydrochloride (1:2)

{[4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]methyl}amine dihydrochloride

CAS: 1255717-31-7

Formula: C₆H₁₄Cl₂N₄O

Purity: 95.0%

Molecular weight: 229.11

Ref: 10-F359311