
CAS 1255717-32-8
:Piperidine, 4-[(2-methylphenyl)thio]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-methylphenyl)thio]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of a thioether group, specifically a 2-methylphenyl thio substituent at the 4-position of the piperidine ring, contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. The compound's stability, reactivity, and solubility are influenced by the presence of the hydrochloride moiety. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific class of piperidine derivatives that may have applications in drug development and research.
Formula:C12H17NS·ClH
InChI:InChI=1S/C12H17NS.ClH/c1-10-4-2-3-5-12(10)14-11-6-8-13-9-7-11;/h2-5,11,13H,6-9H2,1H3;1H
InChI key:InChIKey=TWUXYIMKXVBBFU-UHFFFAOYSA-N
SMILES:S(C1=C(C)C=CC=C1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-[(2-methylphenyl)thio]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.