CAS 1255717-33-9

4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-α-methyl-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-α-methyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amine functional group, contributing to its potential as a building block in pharmaceuticals and agrochemicals. The presence of the methoxyethyl group enhances its solubility and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including drug formulation. The compound's unique structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity.

Formula: C₇H₁₄N₄O·2ClH

InChI: InChI=1S/C7H14N4O.2ClH/c1-6(8)7-10-9-5-11(7)3-4-12-2;;/h5-6H,3-4,8H2,1-2H3;2*1H

InChI key: InChIKey=DYBGYLZQSDSNOD-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N(CCOC)C=NN1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4-(2-methoxyethyl)-α-methyl-, hydrochloride (1:2)

{1-[4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]ethyl}amine dihydrochloride

CAS: 1255717-33-9

Formula: C₇H₁₆Cl₂N₄O

Purity: 95.0%

Molecular weight: 243.13

Ref: 10-F359425