CAS 1255717-34-0

1H-1,2,4-Triazol-5-amine, 1-ethyl-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazol-5-amine, 1-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered aromatic ring containing three nitrogen atoms. This compound is typically encountered as a hydrochloride salt, indicating that it is soluble in water and may exhibit basic properties due to the presence of the amine functional group. The ethyl substitution on the triazole ring can influence its biological activity and solubility. Compounds of this type are often studied for their potential applications in pharmaceuticals, particularly as antifungal agents or in other therapeutic roles due to their ability to interact with biological targets. The presence of the hydrochloride form enhances its stability and handling properties. As with many nitrogen-containing heterocycles, it may also exhibit interesting coordination chemistry with metal ions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₄H₈N₄·ClH

InChI: InChI=1S/C4H8N4.ClH/c1-2-8-4(5)6-3-7-8;/h3H,2H2,1H3,(H2,5,6,7);1H

InChI key: InChIKey=IFNIXWDZBBCGLH-UHFFFAOYSA-N

SMILES: C(C)N1C(N)=NC=N1.Cl

Synonyms:

• 1H-1,2,4-Triazol-5-amine, 1-ethyl-, hydrochloride (1:1)