CAS 1255717-37-3

2-Pyrrolidinone, 4-amino-1-propyl-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 4-amino-1-propyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. The presence of an amino group at the 4-position and a propyl chain contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or serving as a precursor in pharmaceutical synthesis. Its molecular structure suggests it could participate in hydrogen bonding, affecting its physical properties such as melting point and solubility. Additionally, the hydrochloride form often stabilizes the compound, making it easier to handle and store. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, 2-Pyrrolidinone, 4-amino-1-propyl-, hydrochloride (1:1) is of interest in both research and industrial contexts, particularly in medicinal chemistry.

Formula: C₇H₁₄N₂O.ClH

InChI: InChI=1S/C7H14N2O.ClH/c1-2-3-9-5-6(8)4-7(9)10;/h6H,2-5,8H2,1H3;1H

InChI key: InChIKey=QMXMFEKULNPIMD-UHFFFAOYSA-N

SMILES: C(CC)N1C(=O)CC(N)C1.Cl

4-amino-1-propyl-2-pyrrolidinone hydrochloride

CAS: 1255717-37-3

Formula: C₇H₁₅ClN₂O

Purity: 95.0%

Molecular weight: 178.66

Ref: 10-F359294

4-Amino-1-propylpyrrolidin-2-one Hydrochloride

Controlled Product

CAS: 1255717-37-3

Applications 4-amino-1-propylpyrrolidin-2-one hydrochloride (cas# 1255717-37-3) is a useful research chemical.

Formula: C₇H₁₄N₂O·HCl

Color and Shape: Neat

Molecular weight: 142.20 + 36.46

Ref: TR-A630930

4-Amino-1-propylpyrrolidin-2-one hydrochloride

CAS: 1255717-37-3

Versatile small molecule scaffold

Formula: C₇H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 178.66 g/mol

Ref: 3D-FAC71737