
CAS 1255717-38-4
:2-Benzoxazolemethanamine, 4-methyl-, hydrochloride (1:1)
Description:
2-Benzoxazolemethanamine, 4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its benzoxazole structure, which features a fused benzene and oxazole ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methyl group at the 4-position of the benzoxazole ring contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is often used in pharmaceutical applications, potentially serving as an intermediate in drug synthesis or as a pharmacologically active agent. The compound's molecular structure suggests it may exhibit various interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H10N2O·ClH
InChI:InChI=1S/C9H10N2O.ClH/c1-6-3-2-4-7-9(6)11-8(5-10)12-7;/h2-4H,5,10H2,1H3;1H
InChI key:InChIKey=YTOLTKHXGDOCSP-UHFFFAOYSA-N
SMILES:CC1=C2C(OC(CN)=N2)=CC=C1.Cl
Synonyms:- 2-Benzoxazolemethanamine, 4-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.