CAS 1255717-41-9

5-Thiazolemethanamine, 4-methyl-2-propyl-, hydrochloride (1:1)

Description:

5-Thiazolemethanamine, 4-methyl-2-propyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amine functional group, contributing to its basicity and potential reactivity. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The specific alkyl substitutions, including a methyl and a propyl group, influence its lipophilicity and biological activity. Such compounds are often investigated for their potential therapeutic effects, including antimicrobial or anti-inflammatory properties. The molecular structure and functional groups play a crucial role in determining the compound's interactions with biological systems, making it of interest in medicinal chemistry. As with many thiazole derivatives, it may exhibit a range of biological activities, warranting further research into its pharmacological potential.

Formula: C₈H₁₄N₂S·ClH

InChI: InChI=1S/C8H14N2S.ClH/c1-3-4-8-10-6(2)7(5-9)11-8;/h3-5,9H2,1-2H3;1H

InChI key: InChIKey=QYTKKOBPUFDVSF-UHFFFAOYSA-N

SMILES: C(CC)C=1SC(CN)=C(C)N1.Cl

Synonyms:

• 5-Thiazolemethanamine, 4-methyl-2-propyl-, hydrochloride (1:1)

[(4-methyl-2-propyl-1,3-thiazol-5-yl)methyl]amine hydrochloride

CAS: 1255717-41-9

Formula: C₈H₁₅ClN₂S

Purity: 95.0%

Molecular weight: 206.73

Ref: 10-F359834