
CAS 1255717-42-0
:Pyrido[4,3-d]pyrimidine-2(1H)-thione, 5,6,7,8-tetrahydro-6-methyl-, sodium salt (1:1)
Description:
Pyrido[4,3-d]pyrimidine-2(1H)-thione, 5,6,7,8-tetrahydro-6-methyl-, sodium salt (1:1) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The sodium salt form suggests that it is soluble in water, enhancing its utility in various applications, including pharmaceuticals and biochemistry. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, which can influence its stability and reactivity. Additionally, the presence of a methyl group at the 6-position of the tetrahydro structure may affect its electronic properties and steric hindrance. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its precise biological activities and potential applications.
Formula:C8H11N3S·Na
InChI:InChI=1S/C8H11N3S.Na/c1-11-3-2-7-6(5-11)4-9-8(12)10-7;/h4H,2-3,5H2,1H3,(H,9,10,12);
InChI key:InChIKey=KJUUUUAHWKZBMV-UHFFFAOYSA-N
SMILES:CN1CC2=C(NC(=S)N=C2)CC1.[Na]
Synonyms:- Pyrido[4,3-d]pyrimidine-2(1H)-thione, 5,6,7,8-tetrahydro-6-methyl-, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.