
CAS 1255717-46-4
:1H-Imidazol-2-amine, 5-(4-chlorophenyl)-, hydrate (1:1)
Description:
1H-Imidazol-2-amine, 5-(4-chlorophenyl)-, hydrate (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a 4-chlorophenyl group, indicating the presence of a chlorine substituent on a phenyl ring, which can influence its reactivity and biological activity. The hydrate form suggests that the compound can associate with water molecules, which may affect its solubility and stability. Typically, imidazole derivatives are known for their diverse biological activities, including antimicrobial and antifungal properties. The presence of the amine functional group further enhances its potential for hydrogen bonding and reactivity in various chemical reactions. The specific characteristics, such as melting point, solubility, and spectral properties, would depend on the precise conditions and the presence of the hydrate. Overall, this compound may have applications in pharmaceuticals or as a building block in organic synthesis, owing to its unique structural features.
Formula:C9H10ClN3O
InChI:InChI=1S/C9H8ClN3.H2O/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8;/h1-5H,(H3,11,12,13);1H2
InChI key:InChIKey=BVNPMFMSPGDRRY-UHFFFAOYSA-N
SMILES:NC=1NC(C2=CC=C(Cl)C=C2)=CN1.O
Synonyms:- 1H-Imidazol-2-amine, 5-(4-chlorophenyl)-, hydrate (1:1)
- 5-(4-Chlorophenyl)-1H-imidazol-2-amine hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.